C43H52F2N3O5+ — CID 139963927
N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-7-[8-(1-methylpiperidin-1-ium-1-yl)octoxy]-4-oxo-N-prop-2-ynylquinoline-3-carboxamide (PubChem CID 139963927) has the molecular formula C43H52F2N3O5+ and a molecular weight of 728.90 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-7-[8-(1-methylpiperidin-1-ium-1-yl)octoxy]-4-oxo-N-prop-2-ynylquinoline-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-7-[8-(1-methylpiperidin-1-ium-1-yl)octoxy]-4-oxo-N-prop-2-ynylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963927 |
| Molecular Formula | C43H52F2N3O5+ |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.39 |
| IUPAC Name | N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-7-[8-(1-methylpiperidin-1-ium-1-yl)octoxy]-4-oxo-N-prop-2-ynylquinoline-3-carboxamide |
| SMILES | C#CCN(C(=O)c1cn(-c2cc(OC)cc(OCCC)c2)c2cc(OCCCCCCCC[N+]3(C)CCCCC3)ccc2c1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C43H52F2N3O5/c1-5-18-46(34-25-32(44)24-33(45)26-34)43(50)40-31-47(35-27-37(51-4)29-38(28-35)52-22-6-2)41-30-36(16-17-39(41)42(40)49)53-23-15-10-8-7-9-12-19-48(3)20-13-11-14-21-48/h1,16-17,24-31H,6-15,18-23H2,2-4H3/q+1 |
| InChIKey | UKFSPJSMQFBMKM-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|