C43H50BrF2N3O5 — CID 139964135
7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-4-oxo-N-prop-2-ynylquinoline-3-carboxamide bromide (PubChem CID 139964135) has the molecular formula C43H50BrF2N3O5 and a molecular weight of 806.79 g/mol. Its IUPAC name is 7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-4-oxo-N-prop-2-ynylquinoline-3-carboxamide bromide.
| Compound Name | 7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-4-oxo-N-prop-2-ynylquinoline-3-carboxamide bromide |
|---|---|
| PubChem CID | 139964135 |
| Molecular Formula | C43H50BrF2N3O5 |
| Molecular Weight | 806.79 g/mol |
| Exact Mass | 805.29 |
| IUPAC Name | 7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3-methoxy-5-propoxyphenyl)-4-oxo-N-prop-2-ynylquinoline-3-carboxamide bromide |
| SMILES | C#CCN(C(=O)c1cn(-c2cc(OC)cc(OCCC)c2)c2cc(OCCCCCCC[N+]34CCC(CC3)CC4)ccc2c1=O)c1cc(F)cc(F)c1.[Br-] |
| InChI | InChI=1S/C43H50F2N3O5.BrH/c1-4-16-46(34-24-32(44)23-33(45)25-34)43(50)40-30-47(35-26-37(51-3)28-38(27-35)52-21-5-2)41-29-36(11-12-39(41)42(40)49)53-22-10-8-6-7-9-17-48-18-13-31(14-19-48)15-20-48;/h1,11-12,23-31H,5-10,13-22H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | GSLIIIIQDAWUPU-UHFFFAOYSA-M |
| XLogP | 5.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|