C36H36F2N3O5+ — CID 139963951
N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[4-(1-methylpyridin-1-ium-3-yl)butoxy]-4-oxoquinoline-3-carboxamide (PubChem CID 139963951) has the molecular formula C36H36F2N3O5+ and a molecular weight of 628.70 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[4-(1-methylpyridin-1-ium-3-yl)butoxy]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[4-(1-methylpyridin-1-ium-3-yl)butoxy]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963951 |
| Molecular Formula | C36H36F2N3O5+ |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[4-(1-methylpyridin-1-ium-3-yl)butoxy]-4-oxoquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1cn(-c2cc(OC)cc(OC)c2)c2cc(OCCCCc3ccc[n+](C)c3)ccc2c1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C36H36F2N3O5/c1-5-40(27-16-25(37)15-26(38)17-27)36(43)33-23-41(28-18-30(44-3)20-31(19-28)45-4)34-21-29(11-12-32(34)35(33)42)46-14-7-6-9-24-10-8-13-39(2)22-24/h8,10-13,15-23H,5-7,9,14H2,1-4H3/q+1 |
| InChIKey | HAJOJVQTSRRSMW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|