C44H44F2N3O5+ — CID 139963816
N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxo-7-[7-(3-phenylpyridin-1-ium-1-yl)heptoxy]quinoline-3-carboxamide (PubChem CID 139963816) has the molecular formula C44H44F2N3O5+ and a molecular weight of 732.85 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxo-7-[7-(3-phenylpyridin-1-ium-1-yl)heptoxy]quinoline-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxo-7-[7-(3-phenylpyridin-1-ium-1-yl)heptoxy]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963816 |
| Molecular Formula | C44H44F2N3O5+ |
| Molecular Weight | 732.85 g/mol |
| Exact Mass | 732.32 |
| IUPAC Name | N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxo-7-[7-(3-phenylpyridin-1-ium-1-yl)heptoxy]quinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1cn(-c2cc(OC)cc(OC)c2)c2cc(OCCCCCCC[n+]3cccc(-c4ccccc4)c3)ccc2c1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C44H44F2N3O5/c1-4-48(35-23-33(45)22-34(46)24-35)44(51)41-30-49(36-25-38(52-2)27-39(26-36)53-3)42-28-37(17-18-40(42)43(41)50)54-21-12-7-5-6-11-19-47-20-13-16-32(29-47)31-14-9-8-10-15-31/h8-10,13-18,20,22-30H,4-7,11-12,19,21H2,1-3H3/q+1 |
| InChIKey | MBIGBRXSMDNUIH-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|