C34H31F2N3O5 — CID 139963749
N-(3,5-difluorophenyl)-N-ethyl-7-methoxy-1-[3-methoxy-5-(3-pyridin-3-ylpropoxy)phenyl]-4-oxoquinoline-3-carboxamide (PubChem CID 139963749) has the molecular formula C34H31F2N3O5 and a molecular weight of 599.63 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-N-ethyl-7-methoxy-1-[3-methoxy-5-(3-pyridin-3-ylpropoxy)phenyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-N-ethyl-7-methoxy-1-[3-methoxy-5-(3-pyridin-3-ylpropoxy)phenyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963749 |
| Molecular Formula | C34H31F2N3O5 |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | N-(3,5-difluorophenyl)-N-ethyl-7-methoxy-1-[3-methoxy-5-(3-pyridin-3-ylpropoxy)phenyl]-4-oxoquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1cn(-c2cc(OC)cc(OCCCc3cccnc3)c2)c2cc(OC)ccc2c1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C34H31F2N3O5/c1-4-38(25-14-23(35)13-24(36)15-25)34(41)31-21-39(32-19-27(42-2)9-10-30(32)33(31)40)26-16-28(43-3)18-29(17-26)44-12-6-8-22-7-5-11-37-20-22/h5,7,9-11,13-21H,4,6,8,12H2,1-3H3 |
| InChIKey | KESSBQKGHNSYMG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|