C24H19ClN2O3 — CID 141352866
3-chloro-N-[(7-methoxy-4-oxo-1-phenylquinolin-3-yl)methyl]benzamide (PubChem CID 141352866) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is 3-chloro-N-[(7-methoxy-4-oxo-1-phenylquinolin-3-yl)methyl]benzamide.
| Compound Name | 3-chloro-N-[(7-methoxy-4-oxo-1-phenylquinolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 141352866 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 3-chloro-N-[(7-methoxy-4-oxo-1-phenylquinolin-3-yl)methyl]benzamide |
| SMILES | COc1ccc2c(=O)c(CNC(=O)c3cccc(Cl)c3)cn(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H19ClN2O3/c1-30-20-10-11-21-22(13-20)27(19-8-3-2-4-9-19)15-17(23(21)28)14-26-24(29)16-6-5-7-18(25)12-16/h2-13,15H,14H2,1H3,(H,26,29) |
| InChIKey | BISGLIOCGYXNQN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |