C24H17ClF3N3O3 — CID 71208229
1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 71208229) has the molecular formula C24H17ClF3N3O3 and a molecular weight of 487.87 g/mol. Its IUPAC name is 1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 71208229 |
| Molecular Formula | C24H17ClF3N3O3 |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCc1cn(-c2ccccc2)c2cc(Cl)ccc2c1=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H17ClF3N3O3/c25-16-6-11-20-21(12-16)31(18-4-2-1-3-5-18)14-15(22(20)32)13-29-23(33)30-17-7-9-19(10-8-17)34-24(26,27)28/h1-12,14H,13H2,(H2,29,30,33) |
| InChIKey | RQWWNSBQHZRULI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |