C26H20ClF3N4O5 — CID 175408133
2-(benzylamino)-3-[5-chloro-3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]indol-1-yl]-3-oxopropanoic acid (PubChem CID 175408133) has the molecular formula C26H20ClF3N4O5 and a molecular weight of 560.92 g/mol. Its IUPAC name is 2-(benzylamino)-3-[5-chloro-3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]indol-1-yl]-3-oxopropanoic acid.
| Compound Name | 2-(benzylamino)-3-[5-chloro-3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]indol-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 175408133 |
| Molecular Formula | C26H20ClF3N4O5 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 2-(benzylamino)-3-[5-chloro-3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]indol-1-yl]-3-oxopropanoic acid |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1cn(C(=O)C(NCc2ccccc2)C(=O)O)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H20ClF3N4O5/c27-16-6-11-21-19(12-16)20(33-25(38)32-17-7-9-18(10-8-17)39-26(28,29)30)14-34(21)23(35)22(24(36)37)31-13-15-4-2-1-3-5-15/h1-12,14,22,31H,13H2,(H,36,37)(H2,32,33,38) |
| InChIKey | ZPBGKMUZMDJWHX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|