C28H38O6 — CID 139891609
[3-acetyloxy-2,3-bis(4-butoxyphenyl)butan-2-yl] acetate (PubChem CID 139891609) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is [3-acetyloxy-2,3-bis(4-butoxyphenyl)butan-2-yl] acetate.
| Compound Name | [3-acetyloxy-2,3-bis(4-butoxyphenyl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 139891609 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | [3-acetyloxy-2,3-bis(4-butoxyphenyl)butan-2-yl] acetate |
| SMILES | CCCCOc1ccc(C(C)(OC(C)=O)C(C)(OC(C)=O)c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H38O6/c1-7-9-19-31-25-15-11-23(12-16-25)27(5,33-21(3)29)28(6,34-22(4)30)24-13-17-26(18-14-24)32-20-10-8-2/h11-18H,7-10,19-20H2,1-6H3 |
| InChIKey | RPNSXNZXCQOYRS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|