C42H84ClNO3 — CID 139892563
2-hydroxyethyl-bis[2-[(Z)-octadec-9-enoxy]ethyl]azanium chloride (PubChem CID 139892563) has the molecular formula C42H84ClNO3 and a molecular weight of 686.59 g/mol. Its IUPAC name is 2-hydroxyethyl-bis[2-[(Z)-octadec-9-enoxy]ethyl]azanium chloride.
| Compound Name | 2-hydroxyethyl-bis[2-[(Z)-octadec-9-enoxy]ethyl]azanium chloride |
|---|---|
| PubChem CID | 139892563 |
| Molecular Formula | C42H84ClNO3 |
| Molecular Weight | 686.59 g/mol |
| Exact Mass | 685.61 |
| IUPAC Name | 2-hydroxyethyl-bis[2-[(Z)-octadec-9-enoxy]ethyl]azanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC[NH+](CCO)CCOCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C42H83NO3.ClH/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-45-41-36-43(35-38-44)37-42-46-40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20,44H,3-16,21-42H2,1-2H3;1H/b19-17-,20-18-; |
| InChIKey | TVMVDKODEIZPPM-AWLASTDMSA-N |
| XLogP | 7.98 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.59 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|