C30H42N2O3 — CID 139893607
2,6-ditert-butyl-4-[4-[2-[2-[2-(ethylamino)ethyl]-4-methylphenoxy]ethyl]-1,3-oxazol-2-yl]phenol (PubChem CID 139893607) has the molecular formula C30H42N2O3 and a molecular weight of 478.68 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[4-[2-[2-[2-(ethylamino)ethyl]-4-methylphenoxy]ethyl]-1,3-oxazol-2-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[4-[2-[2-[2-(ethylamino)ethyl]-4-methylphenoxy]ethyl]-1,3-oxazol-2-yl]phenol |
|---|---|
| PubChem CID | 139893607 |
| Molecular Formula | C30H42N2O3 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | 2,6-ditert-butyl-4-[4-[2-[2-[2-(ethylamino)ethyl]-4-methylphenoxy]ethyl]-1,3-oxazol-2-yl]phenol |
| SMILES | CCNCCc1cc(C)ccc1OCCc1coc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C30H42N2O3/c1-9-31-14-12-21-16-20(2)10-11-26(21)34-15-13-23-19-35-28(32-23)22-17-24(29(3,4)5)27(33)25(18-22)30(6,7)8/h10-11,16-19,31,33H,9,12-15H2,1-8H3 |
| InChIKey | GNFVQHYAQHBSBY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|