C17H9ClF4N2O3 — CID 139895632
2-[4-chloro-2-fluoro-5-(2-hydroxyphenoxy)phenyl]-5-(trifluoromethyl)pyridazin-3-one (PubChem CID 139895632) has the molecular formula C17H9ClF4N2O3 and a molecular weight of 400.72 g/mol. Its IUPAC name is 2-[4-chloro-2-fluoro-5-(2-hydroxyphenoxy)phenyl]-5-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-[4-chloro-2-fluoro-5-(2-hydroxyphenoxy)phenyl]-5-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 139895632 |
| Molecular Formula | C17H9ClF4N2O3 |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2-[4-chloro-2-fluoro-5-(2-hydroxyphenoxy)phenyl]-5-(trifluoromethyl)pyridazin-3-one |
| SMILES | O=c1cc(C(F)(F)F)cnn1-c1cc(Oc2ccccc2O)c(Cl)cc1F |
| InChI | InChI=1S/C17H9ClF4N2O3/c18-10-6-11(19)12(7-15(10)27-14-4-2-1-3-13(14)25)24-16(26)5-9(8-23-24)17(20,21)22/h1-8,25H |
| InChIKey | VNIQZEUTNPICBA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |