C16H7ClF4N4O4 — CID 18364638
2-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-(trifluoromethyl)pyridazin-3-one (PubChem CID 18364638) has the molecular formula C16H7ClF4N4O4 and a molecular weight of 430.70 g/mol. Its IUPAC name is 2-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 18364638 |
| Molecular Formula | C16H7ClF4N4O4 |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-(trifluoromethyl)pyridazin-3-one |
| SMILES | O=c1cc(C(F)(F)F)cnn1-c1cc(Oc2ncccc2[N+](=O)[O-])c(Cl)cc1F |
| InChI | InChI=1S/C16H7ClF4N4O4/c17-9-5-10(18)12(24-14(26)4-8(7-23-24)16(19,20)21)6-13(9)29-15-11(25(27)28)2-1-3-22-15/h1-7H |
| InChIKey | ZOWCZJNPZFGQPJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|