C17H11ClFN3O6 — CID 18364639
3-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione (PubChem CID 18364639) has the molecular formula C17H11ClFN3O6 and a molecular weight of 407.74 g/mol. Its IUPAC name is 3-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 18364639 |
| Molecular Formula | C17H11ClFN3O6 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 3-[4-chloro-2-fluoro-5-[(3-nitro-2-pyridinyl)oxy]phenyl]-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| SMILES | CC(C)=C1OC(=O)N(c2cc(Oc3ncccc3[N+](=O)[O-])c(Cl)cc2F)C1=O |
| InChI | InChI=1S/C17H11ClFN3O6/c1-8(2)14-16(23)21(17(24)28-14)12-7-13(9(18)6-10(12)19)27-15-11(22(25)26)4-3-5-20-15/h3-7H,1-2H3 |
| InChIKey | LUWXGZLFIGSEPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|