C13H11ClFNO4 — CID 14695619
3-(4-chloro-2-fluoro-5-methoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione (PubChem CID 14695619) has the molecular formula C13H11ClFNO4 and a molecular weight of 299.69 g/mol. Its IUPAC name is 3-(4-chloro-2-fluoro-5-methoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(4-chloro-2-fluoro-5-methoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 14695619 |
| Molecular Formula | C13H11ClFNO4 |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-(4-chloro-2-fluoro-5-methoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| SMILES | COc1cc(N2C(=O)OC(=C(C)C)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C13H11ClFNO4/c1-6(2)11-12(17)16(13(18)20-11)9-5-10(19-3)7(14)4-8(9)15/h4-5H,1-3H3 |
| InChIKey | YXRVAGYMYSAHEV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|