C16H8ClF4N5O5 — CID 12054393
1-amino-3-[4-chloro-2-fluoro-5-[(5-nitro-2-pyridinyl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 12054393) has the molecular formula C16H8ClF4N5O5 and a molecular weight of 461.72 g/mol. Its IUPAC name is 1-amino-3-[4-chloro-2-fluoro-5-[(5-nitro-2-pyridinyl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-amino-3-[4-chloro-2-fluoro-5-[(5-nitro-2-pyridinyl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12054393 |
| Molecular Formula | C16H8ClF4N5O5 |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 1-amino-3-[4-chloro-2-fluoro-5-[(5-nitro-2-pyridinyl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Nn1c(C(F)(F)F)cc(=O)n(-c2cc(Oc3ccc([N+](=O)[O-])cn3)c(Cl)cc2F)c1=O |
| InChI | InChI=1S/C16H8ClF4N5O5/c17-8-3-9(18)10(4-11(8)31-13-2-1-7(6-23-13)26(29)30)24-14(27)5-12(16(19,20)21)25(22)15(24)28/h1-6H,22H2 |
| InChIKey | KQLZJDWHIZHMRT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|