C15H11ClF4N4O5 — CID 171471617
(2S)-2-[(E)-[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methylideneamino]oxypropanoic acid (PubChem CID 171471617) has the molecular formula C15H11ClF4N4O5 and a molecular weight of 438.72 g/mol. Its IUPAC name is (2S)-2-[(E)-[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methylideneamino]oxypropanoic acid.
| Compound Name | (2S)-2-[(E)-[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methylideneamino]oxypropanoic acid |
|---|---|
| PubChem CID | 171471617 |
| Molecular Formula | C15H11ClF4N4O5 |
| Molecular Weight | 438.72 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | (2S)-2-[(E)-[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methylideneamino]oxypropanoic acid |
| SMILES | C[C@H](O/N=C/c1cc(-n2c(=O)cc(C(F)(F)F)n(N)c2=O)c(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H11ClF4N4O5/c1-6(13(26)27)29-22-5-7-2-10(9(17)3-8(7)16)23-12(25)4-11(15(18,19)20)24(21)14(23)28/h2-6H,21H2,1H3,(H,26,27)/b22-5+/t6-/m0/s1 |
| InChIKey | WLJCLNFRFLDMHX-VEOBWPPWSA-N |
| XLogP | 1.35 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.72 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|