C15H13ClF4N4O5 — CID 18788059
ethyl N-[[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methoxy]carbamate (PubChem CID 18788059) has the molecular formula C15H13ClF4N4O5 and a molecular weight of 440.74 g/mol. Its IUPAC name is ethyl N-[[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methoxy]carbamate.
| Compound Name | ethyl N-[[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methoxy]carbamate |
|---|---|
| PubChem CID | 18788059 |
| Molecular Formula | C15H13ClF4N4O5 |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | ethyl N-[[5-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-chloro-4-fluorophenyl]methoxy]carbamate |
| SMILES | CCOC(=O)NOCc1cc(-n2c(=O)cc(C(F)(F)F)n(N)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C15H13ClF4N4O5/c1-2-28-13(26)22-29-6-7-3-10(9(17)4-8(7)16)23-12(25)5-11(15(18,19)20)24(21)14(23)27/h3-5H,2,6,21H2,1H3,(H,22,26) |
| InChIKey | FNYZGRSMYNZQTC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|