C13H10F4N4O3S — CID 59900054
4-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-fluoro-2-methoxybenzenecarbothioamide (PubChem CID 59900054) has the molecular formula C13H10F4N4O3S and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-fluoro-2-methoxybenzenecarbothioamide.
| Compound Name | 4-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-fluoro-2-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 59900054 |
| Molecular Formula | C13H10F4N4O3S |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 4-[3-amino-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-fluoro-2-methoxybenzenecarbothioamide |
| SMILES | COc1cc(-n2c(=O)cc(C(F)(F)F)n(N)c2=O)c(F)cc1C(N)=S |
| InChI | InChI=1S/C13H10F4N4O3S/c1-24-8-3-7(6(14)2-5(8)11(18)25)20-10(22)4-9(13(15,16)17)21(19)12(20)23/h2-4H,19H2,1H3,(H2,18,25) |
| InChIKey | HJIOFYSVAFDOSQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|