C18H18F4N2O3Si — CID 21265638
3-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 21265638) has the molecular formula C18H18F4N2O3Si and a molecular weight of 414.43 g/mol. Its IUPAC name is 3-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21265638 |
| Molecular Formula | C18H18F4N2O3Si |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | COc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H18F4N2O3Si/c1-23-15(18(20,21)22)10-16(25)24(17(23)26)13-9-14(27-2)11(8-12(13)19)6-7-28(3,4)5/h8-10H,1-5H3 |
| InChIKey | HQIZUPXWOQYGIQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|