C20H18F4N2O3Si — CID 70219892
3-[5-fluoro-2-methyl-7-(2-trimethylsilylethynyl)-1-benzofuran-4-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 70219892) has the molecular formula C20H18F4N2O3Si and a molecular weight of 438.45 g/mol. Its IUPAC name is 3-[5-fluoro-2-methyl-7-(2-trimethylsilylethynyl)-1-benzofuran-4-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[5-fluoro-2-methyl-7-(2-trimethylsilylethynyl)-1-benzofuran-4-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70219892 |
| Molecular Formula | C20H18F4N2O3Si |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-[5-fluoro-2-methyl-7-(2-trimethylsilylethynyl)-1-benzofuran-4-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc2c(-n3c(=O)cc(C(F)(F)F)n(C)c3=O)c(F)cc(C#C[Si](C)(C)C)c2o1 |
| InChI | InChI=1S/C20H18F4N2O3Si/c1-11-8-13-17(14(21)9-12(18(13)29-11)6-7-30(3,4)5)26-16(27)10-15(20(22,23)24)25(2)19(26)28/h8-10H,1-5H3 |
| InChIKey | LRZGAXPQCJGLKH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|