C12H8ClF4N3O2 — CID 86585906
3-(2-amino-4-chloro-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 86585906) has the molecular formula C12H8ClF4N3O2 and a molecular weight of 337.66 g/mol. Its IUPAC name is 3-(2-amino-4-chloro-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(2-amino-4-chloro-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 86585906 |
| Molecular Formula | C12H8ClF4N3O2 |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-(2-amino-4-chloro-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2c(N)cc(Cl)cc2F)c1=O |
| InChI | InChI=1S/C12H8ClF4N3O2/c1-19-8(12(15,16)17)4-9(21)20(11(19)22)10-6(14)2-5(13)3-7(10)18/h2-4H,18H2,1H3 |
| InChIKey | RFKBONZFHHUHCC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|