C13H8ClF4N3O4 — CID 56991091
3-(4-chloro-6-fluoro-3-methyl-2-nitrophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 56991091) has the molecular formula C13H8ClF4N3O4 and a molecular weight of 381.67 g/mol. Its IUPAC name is 3-(4-chloro-6-fluoro-3-methyl-2-nitrophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(4-chloro-6-fluoro-3-methyl-2-nitrophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56991091 |
| Molecular Formula | C13H8ClF4N3O4 |
| Molecular Weight | 381.67 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 3-(4-chloro-6-fluoro-3-methyl-2-nitrophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(Cl)cc(F)c(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8ClF4N3O4/c1-5-6(14)3-7(15)11(10(5)21(24)25)20-9(22)4-8(13(16,17)18)19(2)12(20)23/h3-4H,1-2H3 |
| InChIKey | NRPHSHDHPVKZNP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|