C12H10F4N4O2 — CID 134107140
3-(2,3-diamino-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 134107140) has the molecular formula C12H10F4N4O2 and a molecular weight of 318.23 g/mol. Its IUPAC name is 3-(2,3-diamino-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(2,3-diamino-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134107140 |
| Molecular Formula | C12H10F4N4O2 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-(2,3-diamino-6-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2c(F)ccc(N)c2N)c1=O |
| InChI | InChI=1S/C12H10F4N4O2/c1-19-7(12(14,15)16)4-8(21)20(11(19)22)10-5(13)2-3-6(17)9(10)18/h2-4H,17-18H2,1H3 |
| InChIKey | QOHRGYCRLOLMHE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|