C22H24F4N2O4SSi — CID 21265543
3-[5-cyclopentylsulfonyl-2-fluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 21265543) has the molecular formula C22H24F4N2O4SSi and a molecular weight of 516.59 g/mol. Its IUPAC name is 3-[5-cyclopentylsulfonyl-2-fluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[5-cyclopentylsulfonyl-2-fluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21265543 |
| Molecular Formula | C22H24F4N2O4SSi |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 3-[5-cyclopentylsulfonyl-2-fluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2cc(S(=O)(=O)C3CCCC3)c(C#C[Si](C)(C)C)cc2F)c1=O |
| InChI | InChI=1S/C22H24F4N2O4SSi/c1-27-19(22(24,25)26)13-20(29)28(21(27)30)17-12-18(33(31,32)15-7-5-6-8-15)14(11-16(17)23)9-10-34(2,3)4/h11-13,15H,5-8H2,1-4H3 |
| InChIKey | JWBYIOZXJRNUNY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|