C17H15F5N2O2Si — CID 134115794
3-[3,5-difluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 134115794) has the molecular formula C17H15F5N2O2Si and a molecular weight of 402.40 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[3,5-difluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134115794 |
| Molecular Formula | C17H15F5N2O2Si |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-[3,5-difluoro-4-(2-trimethylsilylethynyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2cc(F)c(C#C[Si](C)(C)C)c(F)c2)c1=O |
| InChI | InChI=1S/C17H15F5N2O2Si/c1-23-14(17(20,21)22)9-15(25)24(16(23)26)10-7-12(18)11(13(19)8-10)5-6-27(2,3)4/h7-9H,1-4H3 |
| InChIKey | DPNRHKRUAPMEMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|