C17H15F4N3O2Si — CID 134115985
1-amino-3-[4-[2-[ethenyl(dimethyl)silyl]ethynyl]-3-fluorophenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 134115985) has the molecular formula C17H15F4N3O2Si and a molecular weight of 397.40 g/mol. Its IUPAC name is 1-amino-3-[4-[2-[ethenyl(dimethyl)silyl]ethynyl]-3-fluorophenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-amino-3-[4-[2-[ethenyl(dimethyl)silyl]ethynyl]-3-fluorophenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134115985 |
| Molecular Formula | C17H15F4N3O2Si |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-amino-3-[4-[2-[ethenyl(dimethyl)silyl]ethynyl]-3-fluorophenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C=C[Si](C)(C)C#Cc1ccc(-n2c(=O)cc(C(F)(F)F)n(N)c2=O)cc1F |
| InChI | InChI=1S/C17H15F4N3O2Si/c1-4-27(2,3)8-7-11-5-6-12(9-13(11)18)23-15(25)10-14(17(19,20)21)24(22)16(23)26/h4-6,9-10H,1,22H2,2-3H3 |
| InChIKey | YTNUINLXYSWVCG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|