C11H7ClF3N3O2 — CID 134123749
3-(6-chloro-3-pyridinyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 134123749) has the molecular formula C11H7ClF3N3O2 and a molecular weight of 305.64 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(6-chloro-3-pyridinyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134123749 |
| Molecular Formula | C11H7ClF3N3O2 |
| Molecular Weight | 305.64 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2ccc(Cl)nc2)c1=O |
| InChI | InChI=1S/C11H7ClF3N3O2/c1-17-7(11(13,14)15)4-9(19)18(10(17)20)6-2-3-8(12)16-5-6/h2-5H,1H3 |
| InChIKey | ULNURJHRNRVAPE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|