C16H14ClF3N2O3 — CID 57297712
3-(3-but-2-en-2-yloxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 57297712) has the molecular formula C16H14ClF3N2O3 and a molecular weight of 374.75 g/mol. Its IUPAC name is 3-(3-but-2-en-2-yloxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(3-but-2-en-2-yloxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57297712 |
| Molecular Formula | C16H14ClF3N2O3 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-(3-but-2-en-2-yloxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC=C(C)Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C16H14ClF3N2O3/c1-4-9(2)25-12-7-10(5-6-11(12)17)22-14(23)8-13(16(18,19)20)21(3)15(22)24/h4-8H,1-3H3 |
| InChIKey | WMGJGPZCFMJXAQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|