C14H12Cl2F3N2O5P — CID 70222006
[1-chloro-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]ethyl]phosphonic acid (PubChem CID 70222006) has the molecular formula C14H12Cl2F3N2O5P and a molecular weight of 447.13 g/mol. Its IUPAC name is [1-chloro-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]ethyl]phosphonic acid.
| Compound Name | [1-chloro-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 70222006 |
| Molecular Formula | C14H12Cl2F3N2O5P |
| Molecular Weight | 447.13 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | [1-chloro-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]ethyl]phosphonic acid |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2ccc(Cl)c(CC(Cl)P(=O)(O)O)c2)c1=O |
| InChI | InChI=1S/C14H12Cl2F3N2O5P/c1-20-10(14(17,18)19)6-12(22)21(13(20)23)8-2-3-9(15)7(4-8)5-11(16)27(24,25)26/h2-4,6,11H,5H2,1H3,(H2,24,25,26) |
| InChIKey | SKZWKQMHYFMZPU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|