C15H8BrCl2F3N2O3 — CID 59957612
(Z)-2-bromo-3-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoyl chloride (PubChem CID 59957612) has the molecular formula C15H8BrCl2F3N2O3 and a molecular weight of 472.04 g/mol. Its IUPAC name is (Z)-2-bromo-3-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoyl chloride.
| Compound Name | (Z)-2-bromo-3-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoyl chloride |
|---|---|
| PubChem CID | 59957612 |
| Molecular Formula | C15H8BrCl2F3N2O3 |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 469.90 |
| IUPAC Name | (Z)-2-bromo-3-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoyl chloride |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2ccc(Cl)c(/C=C(\Br)C(=O)Cl)c2)c1=O |
| InChI | InChI=1S/C15H8BrCl2F3N2O3/c1-22-11(15(19,20)21)6-12(24)23(14(22)26)8-2-3-10(17)7(4-8)5-9(16)13(18)25/h2-6H,1H3/b9-5- |
| InChIKey | GGOQSFHKEBIWDE-UITAMQMPSA-N |
| XLogP | 3.71 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|