C19H17BrClF3N2O4S — CID 173283213
2-ethylsulfanylethyl 3-bromo-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoate (PubChem CID 173283213) has the molecular formula C19H17BrClF3N2O4S and a molecular weight of 541.77 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 3-bromo-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoate.
| Compound Name | 2-ethylsulfanylethyl 3-bromo-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 173283213 |
| Molecular Formula | C19H17BrClF3N2O4S |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | 2-ethylsulfanylethyl 3-bromo-2-[2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]prop-2-enoate |
| SMILES | CCSCCOC(=O)C(=CBr)c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C19H17BrClF3N2O4S/c1-3-31-7-6-30-17(28)13(10-20)12-8-11(4-5-14(12)21)26-16(27)9-15(19(22,23)24)25(2)18(26)29/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | GMKCHSFNBZHFRC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|