C17H14ClF3N2O3 — CID 19009616
3-(4-chloro-3-propanoylphenyl)-1-prop-2-enyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 19009616) has the molecular formula C17H14ClF3N2O3 and a molecular weight of 386.76 g/mol. Its IUPAC name is 3-(4-chloro-3-propanoylphenyl)-1-prop-2-enyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(4-chloro-3-propanoylphenyl)-1-prop-2-enyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19009616 |
| Molecular Formula | C17H14ClF3N2O3 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(4-chloro-3-propanoylphenyl)-1-prop-2-enyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C=CCn1c(C(F)(F)F)cc(=O)n(-c2ccc(Cl)c(C(=O)CC)c2)c1=O |
| InChI | InChI=1S/C17H14ClF3N2O3/c1-3-7-22-14(17(19,20)21)9-15(25)23(16(22)26)10-5-6-12(18)11(8-10)13(24)4-2/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | QWTAOCZUOGQWMB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|