C16H15ClF3N3O3 — CID 86748054
3-[4-chloro-3-(propan-2-yloxyiminomethyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 86748054) has the molecular formula C16H15ClF3N3O3 and a molecular weight of 389.76 g/mol. Its IUPAC name is 3-[4-chloro-3-(propan-2-yloxyiminomethyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[4-chloro-3-(propan-2-yloxyiminomethyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 86748054 |
| Molecular Formula | C16H15ClF3N3O3 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-[4-chloro-3-(propan-2-yloxyiminomethyl)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)ON=Cc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C16H15ClF3N3O3/c1-9(2)26-21-8-10-6-11(4-5-12(10)17)23-14(24)7-13(16(18,19)20)22(3)15(23)25/h4-9H,1-3H3 |
| InChIKey | BAOJYGGWKSCAEA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|