C18H12ClF4N3O3 — CID 23377289
3-[4-[(6-chloro-3-pyridinyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 23377289) has the molecular formula C18H12ClF4N3O3 and a molecular weight of 429.76 g/mol. Its IUPAC name is 3-[4-[(6-chloro-3-pyridinyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[4-[(6-chloro-3-pyridinyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23377289 |
| Molecular Formula | C18H12ClF4N3O3 |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 3-[4-[(6-chloro-3-pyridinyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2ccc(OCc3ccc(Cl)nc3)cc2F)c1=O |
| InChI | InChI=1S/C18H12ClF4N3O3/c1-25-14(18(21,22)23)7-16(27)26(17(25)28)13-4-3-11(6-12(13)20)29-9-10-2-5-15(19)24-8-10/h2-8H,9H2,1H3 |
| InChIKey | MNTCILMJOXEYOJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|