C16H12ClF3N2O3 — CID 57052429
3-(2-but-2-ynoxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 57052429) has the molecular formula C16H12ClF3N2O3 and a molecular weight of 372.73 g/mol. Its IUPAC name is 3-(2-but-2-ynoxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(2-but-2-ynoxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57052429 |
| Molecular Formula | C16H12ClF3N2O3 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 3-(2-but-2-ynoxy-4-chlorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC#CCOc1cc(Cl)ccc1-n1c(=O)cc(C(F)(F)F)n(C)c1=O |
| InChI | InChI=1S/C16H12ClF3N2O3/c1-3-4-7-25-12-8-10(17)5-6-11(12)22-14(23)9-13(16(18,19)20)21(2)15(22)24/h5-6,8-9H,7H2,1-2H3 |
| InChIKey | LTKOJSJTLJSXAP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|