C15H9ClF4N2O3 — CID 19975255
3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 19975255) has the molecular formula C15H9ClF4N2O3 and a molecular weight of 376.69 g/mol. Its IUPAC name is 3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19975255 |
| Molecular Formula | C15H9ClF4N2O3 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCOc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C15H9ClF4N2O3/c1-3-4-25-11-6-10(9(17)5-8(11)16)22-13(23)7-12(15(18,19)20)21(2)14(22)24/h1,5-7H,4H2,2H3 |
| InChIKey | GGKRCNMZBJQSTA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|