C17H10ClF3N2O4 — CID 18506656
3-(7-chloro-5-prop-2-ynoxy-1-benzofuran-3-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 18506656) has the molecular formula C17H10ClF3N2O4 and a molecular weight of 398.72 g/mol. Its IUPAC name is 3-(7-chloro-5-prop-2-ynoxy-1-benzofuran-3-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(7-chloro-5-prop-2-ynoxy-1-benzofuran-3-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18506656 |
| Molecular Formula | C17H10ClF3N2O4 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 3-(7-chloro-5-prop-2-ynoxy-1-benzofuran-3-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCOc1cc(Cl)c2occ(-n3c(=O)cc(C(F)(F)F)n(C)c3=O)c2c1 |
| InChI | InChI=1S/C17H10ClF3N2O4/c1-3-4-26-9-5-10-12(8-27-15(10)11(18)6-9)23-14(24)7-13(17(19,20)21)22(2)16(23)25/h1,5-8H,4H2,2H3 |
| InChIKey | GAWLJBJNHRYGET-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|