C16H10ClF4N3O3S — CID 139895943
2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-prop-2-ynylbenzenecarbothioamide (PubChem CID 139895943) has the molecular formula C16H10ClF4N3O3S and a molecular weight of 435.79 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-prop-2-ynylbenzenecarbothioamide.
| Compound Name | 2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-prop-2-ynylbenzenecarbothioamide |
|---|---|
| PubChem CID | 139895943 |
| Molecular Formula | C16H10ClF4N3O3S |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-prop-2-ynylbenzenecarbothioamide |
| SMILES | C#CCN(O)C(=S)c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C16H10ClF4N3O3S/c1-3-4-23(27)14(28)8-5-11(10(18)6-9(8)17)24-13(25)7-12(16(19,20)21)22(2)15(24)26/h1,5-7,27H,4H2,2H3 |
| InChIKey | KXOYWGHFCFGRJF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|