C17H16ClF4N3O3S — CID 150223828
2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-(2-methylpropyl)benzenecarbothioamide (PubChem CID 150223828) has the molecular formula C17H16ClF4N3O3S and a molecular weight of 453.85 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-(2-methylpropyl)benzenecarbothioamide.
| Compound Name | 2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-(2-methylpropyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 150223828 |
| Molecular Formula | C17H16ClF4N3O3S |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-chloro-4-fluoro-N-hydroxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-(2-methylpropyl)benzenecarbothioamide |
| SMILES | CC(C)CN(O)C(=S)c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C17H16ClF4N3O3S/c1-8(2)7-24(28)15(29)9-4-12(11(19)5-10(9)18)25-14(26)6-13(17(20,21)22)23(3)16(25)27/h4-6,8,28H,7H2,1-3H3 |
| InChIKey | FUAWZNMVXYBDFG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|