C15H12ClF4N3O4 — CID 18740540
methyl (1Z)-2-chloro-4-fluoro-N-methoxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarboximidate (PubChem CID 18740540) has the molecular formula C15H12ClF4N3O4 and a molecular weight of 409.72 g/mol. Its IUPAC name is methyl (1Z)-2-chloro-4-fluoro-N-methoxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarboximidate.
| Compound Name | methyl (1Z)-2-chloro-4-fluoro-N-methoxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 18740540 |
| Molecular Formula | C15H12ClF4N3O4 |
| Molecular Weight | 409.72 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | methyl (1Z)-2-chloro-4-fluoro-N-methoxy-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarboximidate |
| SMILES | CO/N=C(\OC)c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C15H12ClF4N3O4/c1-22-11(15(18,19)20)6-12(24)23(14(22)25)10-4-7(8(16)5-9(10)17)13(26-2)21-27-3/h4-6H,1-3H3/b21-13- |
| InChIKey | FVEFDSNCAHDEMW-BKUYFWCQSA-N |
| XLogP | 2.30 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|