C19H12ClF4N3O5 — CID 11145178
3-[4-[(4-chloro-3-nitrophenyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 11145178) has the molecular formula C19H12ClF4N3O5 and a molecular weight of 473.77 g/mol. Its IUPAC name is 3-[4-[(4-chloro-3-nitrophenyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[4-[(4-chloro-3-nitrophenyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11145178 |
| Molecular Formula | C19H12ClF4N3O5 |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 3-[4-[(4-chloro-3-nitrophenyl)methoxy]-2-fluorophenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2ccc(OCc3ccc(Cl)c([N+](=O)[O-])c3)cc2F)c1=O |
| InChI | InChI=1S/C19H12ClF4N3O5/c1-25-16(19(22,23)24)8-17(28)26(18(25)29)14-5-3-11(7-13(14)21)32-9-10-2-4-12(20)15(6-10)27(30)31/h2-8H,9H2,1H3 |
| InChIKey | QVUIALHWOPTRMM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|