C20H14F4N4O8 — CID 154340700
methyl 3-[4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-nitrophenoxy]-4-methoxypyridine-2-carboxylate (PubChem CID 154340700) has the molecular formula C20H14F4N4O8 and a molecular weight of 514.34 g/mol. Its IUPAC name is methyl 3-[4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-nitrophenoxy]-4-methoxypyridine-2-carboxylate.
| Compound Name | methyl 3-[4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-nitrophenoxy]-4-methoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 154340700 |
| Molecular Formula | C20H14F4N4O8 |
| Molecular Weight | 514.34 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | methyl 3-[4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-nitrophenoxy]-4-methoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1nccc(OC)c1Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14F4N4O8/c1-26-14(20(22,23)24)8-15(29)27(19(26)31)10-7-13(11(28(32)33)6-9(10)21)36-17-12(34-2)4-5-25-16(17)18(30)35-3/h4-8H,1-3H3 |
| InChIKey | XEESSYVSFQPTCP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 144.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|