C18H16F4N4O4 — CID 91226668
5-fluoro-2-[3-(methoxyamino)but-2-en-2-yloxy]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile (PubChem CID 91226668) has the molecular formula C18H16F4N4O4 and a molecular weight of 428.34 g/mol. Its IUPAC name is 5-fluoro-2-[3-(methoxyamino)but-2-en-2-yloxy]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile.
| Compound Name | 5-fluoro-2-[3-(methoxyamino)but-2-en-2-yloxy]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 91226668 |
| Molecular Formula | C18H16F4N4O4 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-fluoro-2-[3-(methoxyamino)but-2-en-2-yloxy]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile |
| SMILES | CONC(C)=C(C)Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1C#N |
| InChI | InChI=1S/C18H16F4N4O4/c1-9(24-29-4)10(2)30-14-6-13(12(19)5-11(14)8-23)26-16(27)7-15(18(20,21)22)25(3)17(26)28/h5-7,24H,1-4H3 |
| InChIKey | PLBRPKVCPWXTHQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|