C20H19F4N3O3S — CID 142607550
ethane;5-fluoro-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-(3-methyl-1-oxobut-2-en-2-yl)sulfanylbenzonitrile (PubChem CID 142607550) has the molecular formula C20H19F4N3O3S and a molecular weight of 457.45 g/mol. Its IUPAC name is ethane;5-fluoro-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-(3-methyl-1-oxobut-2-en-2-yl)sulfanylbenzonitrile.
| Compound Name | ethane;5-fluoro-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-(3-methyl-1-oxobut-2-en-2-yl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 142607550 |
| Molecular Formula | C20H19F4N3O3S |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | ethane;5-fluoro-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-2-(3-methyl-1-oxobut-2-en-2-yl)sulfanylbenzonitrile |
| SMILES | CC.CC(C)=C(C=O)Sc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1C#N |
| InChI | InChI=1S/C18H13F4N3O3S.C2H6/c1-9(2)14(8-26)29-13-5-12(11(19)4-10(13)7-23)25-16(27)6-15(18(20,21)22)24(3)17(25)28;1-2/h4-6,8H,1-3H3;1-2H3 |
| InChIKey | KVVVZSOTDOKJEG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|