C15H10F4N4O3 — CID 15389859
5-fluoro-2-[(E)-methoxyiminomethyl]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile (PubChem CID 15389859) has the molecular formula C15H10F4N4O3 and a molecular weight of 370.26 g/mol. Its IUPAC name is 5-fluoro-2-[(E)-methoxyiminomethyl]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile.
| Compound Name | 5-fluoro-2-[(E)-methoxyiminomethyl]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 15389859 |
| Molecular Formula | C15H10F4N4O3 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-fluoro-2-[(E)-methoxyiminomethyl]-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzonitrile |
| SMILES | CO/N=C/c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1C#N |
| InChI | InChI=1S/C15H10F4N4O3/c1-22-12(15(17,18)19)5-13(24)23(14(22)25)11-4-9(7-21-26-2)8(6-20)3-10(11)16/h3-5,7H,1-2H3/b21-7+ |
| InChIKey | AXSXPFDVTXGQBX-QPSGOUHRSA-N |
| XLogP | 1.55 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|