C15H12F4N4O3 — CID 20661990
3-[2-fluoro-5-[(E)-methoxyiminomethyl]-4-(methylideneamino)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 20661990) has the molecular formula C15H12F4N4O3 and a molecular weight of 372.28 g/mol. Its IUPAC name is 3-[2-fluoro-5-[(E)-methoxyiminomethyl]-4-(methylideneamino)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[2-fluoro-5-[(E)-methoxyiminomethyl]-4-(methylideneamino)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20661990 |
| Molecular Formula | C15H12F4N4O3 |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-[2-fluoro-5-[(E)-methoxyiminomethyl]-4-(methylideneamino)phenyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C=Nc1cc(F)c(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)cc1/C=N/OC |
| InChI | InChI=1S/C15H12F4N4O3/c1-20-10-5-9(16)11(4-8(10)7-21-26-3)23-13(24)6-12(15(17,18)19)22(2)14(23)25/h4-7H,1H2,2-3H3/b21-7+ |
| InChIKey | KQORZAOIYLYLJM-QPSGOUHRSA-N |
| XLogP | 2.01 |
| TPSA | 77.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|