C15H8ClF4N5O5S — CID 18403020
1-amino-3-[4-chloro-2-fluoro-5-[(3-methyl-4-nitro-1,2-thiazol-5-yl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 18403020) has the molecular formula C15H8ClF4N5O5S and a molecular weight of 481.77 g/mol. Its IUPAC name is 1-amino-3-[4-chloro-2-fluoro-5-[(3-methyl-4-nitro-1,2-thiazol-5-yl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-amino-3-[4-chloro-2-fluoro-5-[(3-methyl-4-nitro-1,2-thiazol-5-yl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18403020 |
| Molecular Formula | C15H8ClF4N5O5S |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 1-amino-3-[4-chloro-2-fluoro-5-[(3-methyl-4-nitro-1,2-thiazol-5-yl)oxy]phenyl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cc1nsc(Oc2cc(-n3c(=O)cc(C(F)(F)F)n(N)c3=O)c(F)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H8ClF4N5O5S/c1-5-12(25(28)29)13(31-22-5)30-9-3-8(7(17)2-6(9)16)23-11(26)4-10(15(18,19)20)24(21)14(23)27/h2-4H,21H2,1H3 |
| InChIKey | IELQGBGFUDCCMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|