C23H26N6O3S2 — CID 139897624
6-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylnaphthalene-2-carboximidamide (PubChem CID 139897624) has the molecular formula C23H26N6O3S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 6-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylnaphthalene-2-carboximidamide.
| Compound Name | 6-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylnaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 139897624 |
| Molecular Formula | C23H26N6O3S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 6-[4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylnaphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CN(C)CC5)CC3)ccc2c1 |
| InChI | InChI=1S/C23H26N6O3S2/c1-27-7-6-19-20(14-27)33-22(26-19)23(30)28-8-10-29(11-9-28)34(31,32)18-5-4-15-12-17(21(24)25)3-2-16(15)13-18/h2-5,12-13H,6-11,14H2,1H3,(H3,24,25) |
| InChIKey | CYNXTVSOIZGYMI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|