C21H25N7O3S2 — CID 22710495
2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indole-5-carboximidamide (PubChem CID 22710495) has the molecular formula C21H25N7O3S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indole-5-carboximidamide.
| Compound Name | 2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 22710495 |
| Molecular Formula | C21H25N7O3S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CNC(C)C5)CC3)cc2c1 |
| InChI | InChI=1S/C21H25N7O3S2/c1-12-8-16-17(11-24-12)32-20(26-16)21(29)27-4-6-28(7-5-27)33(30,31)18-10-14-9-13(19(22)23)2-3-15(14)25-18/h2-3,9-10,12,24-25H,4-8,11H2,1H3,(H3,22,23) |
| InChIKey | GXFMWABXEIVNRB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 148.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|